Files
monero_c/patches/0003-coin-control.patch
2024-03-12 19:17:40 +01:00

917 lines
38 KiB
Diff

From a95f52274d4a6a467e06bff60121850adba387ad Mon Sep 17 00:00:00 2001
From: Czarek Nakamoto <cyjan@mrcyjanek.net>
Date: Tue, 12 Mar 2024 11:07:57 +0100
Subject: [PATCH] PATCH: coin control
---
src/wallet/api/CMakeLists.txt | 8 +-
src/wallet/api/coins.cpp | 185 ++++++++++++++++++++++++++++++++++
src/wallet/api/coins.h | 40 ++++++++
src/wallet/api/coins_info.cpp | 122 ++++++++++++++++++++++
src/wallet/api/coins_info.h | 71 +++++++++++++
src/wallet/api/wallet.cpp | 31 +++++-
src/wallet/api/wallet.h | 10 +-
src/wallet/api/wallet2_api.h | 52 +++++++++-
src/wallet/wallet2.cpp | 46 ++++++++-
src/wallet/wallet2.h | 11 +-
10 files changed, 558 insertions(+), 18 deletions(-)
create mode 100644 src/wallet/api/coins.cpp
create mode 100644 src/wallet/api/coins.h
create mode 100644 src/wallet/api/coins_info.cpp
create mode 100644 src/wallet/api/coins_info.h
diff --git a/src/wallet/api/CMakeLists.txt b/src/wallet/api/CMakeLists.txt
index af7948d8a..bb740e2ac 100644
--- a/src/wallet/api/CMakeLists.txt
+++ b/src/wallet/api/CMakeLists.txt
@@ -40,7 +40,9 @@ set(wallet_api_sources
address_book.cpp
subaddress.cpp
subaddress_account.cpp
- unsigned_transaction.cpp)
+ unsigned_transaction.cpp
+ coins.cpp
+ coins_info.cpp)
set(wallet_api_headers
wallet2_api.h)
@@ -55,7 +57,9 @@ set(wallet_api_private_headers
address_book.h
subaddress.h
subaddress_account.h
- unsigned_transaction.h)
+ unsigned_transaction.h
+ coins.h
+ coins_info.h)
monero_private_headers(wallet_api
${wallet_api_private_headers})
diff --git a/src/wallet/api/coins.cpp b/src/wallet/api/coins.cpp
new file mode 100644
index 000000000..2321c638d
--- /dev/null
+++ b/src/wallet/api/coins.cpp
@@ -0,0 +1,185 @@
+#include "coins.h"
+#include "coins_info.h"
+#include "wallet.h"
+#include "crypto/hash.h"
+#include "wallet/wallet2.h"
+#include "common_defines.h"
+
+#include <string>
+#include <vector>
+
+using namespace epee;
+
+namespace Monero {
+
+Coins::~Coins() = default;
+
+CoinsImpl::CoinsImpl(WalletImpl *wallet)
+ : m_wallet(wallet) {}
+
+CoinsImpl::~CoinsImpl()
+{
+ for (auto t : m_rows)
+ delete t;
+}
+
+int CoinsImpl::count() const
+{
+ boost::shared_lock<boost::shared_mutex> lock(m_rowsMutex);
+ int result = m_rows.size();
+ return result;
+}
+
+CoinsInfo *CoinsImpl::coin(int index) const
+{
+ boost::shared_lock<boost::shared_mutex> lock(m_rowsMutex);
+ // sanity check
+ if (index < 0)
+ return nullptr;
+ auto index_ = static_cast<unsigned>(index);
+ return index_ < m_rows.size() ? m_rows[index_] : nullptr;
+}
+
+std::vector<CoinsInfo *> CoinsImpl::getAll() const
+{
+ boost::shared_lock<boost::shared_mutex> lock(m_rowsMutex);
+ return m_rows;
+}
+
+
+void CoinsImpl::refresh()
+{
+ LOG_PRINT_L2("Refreshing coins");
+
+ boost::unique_lock<boost::shared_mutex> lock(m_rowsMutex);
+ boost::shared_lock<boost::shared_mutex> transfers_lock(m_wallet->m_wallet->m_transfers_mutex);
+
+ // delete old outputs;
+ for (auto t : m_rows)
+ delete t;
+ m_rows.clear();
+
+ for (size_t i = 0; i < m_wallet->m_wallet->get_num_transfer_details(); ++i)
+ {
+ const tools::wallet2::transfer_details &td = m_wallet->m_wallet->get_transfer_details(i);
+
+ auto ci = new CoinsInfoImpl();
+ ci->m_blockHeight = td.m_block_height;
+ ci->m_hash = string_tools::pod_to_hex(td.m_txid);
+ ci->m_internalOutputIndex = td.m_internal_output_index;
+ ci->m_globalOutputIndex = td.m_global_output_index;
+ ci->m_spent = td.m_spent;
+ ci->m_frozen = td.m_frozen;
+ ci->m_spentHeight = td.m_spent_height;
+ ci->m_amount = td.m_amount;
+ ci->m_rct = td.m_rct;
+ ci->m_keyImageKnown = td.m_key_image_known;
+ ci->m_pkIndex = td.m_pk_index;
+ ci->m_subaddrIndex = td.m_subaddr_index.minor;
+ ci->m_subaddrAccount = td.m_subaddr_index.major;
+ ci->m_address = m_wallet->m_wallet->get_subaddress_as_str(td.m_subaddr_index); // todo: this is expensive, cache maybe?
+ ci->m_addressLabel = m_wallet->m_wallet->get_subaddress_label(td.m_subaddr_index);
+ ci->m_keyImage = string_tools::pod_to_hex(td.m_key_image);
+ ci->m_unlockTime = td.m_tx.unlock_time;
+ ci->m_unlocked = m_wallet->m_wallet->is_transfer_unlocked(td);
+ ci->m_pubKey = string_tools::pod_to_hex(td.get_public_key());
+ ci->m_coinbase = td.m_tx.vin.size() == 1 && td.m_tx.vin[0].type() == typeid(cryptonote::txin_gen);
+ ci->m_description = m_wallet->m_wallet->get_tx_note(td.m_txid);
+
+ m_rows.push_back(ci);
+ }
+}
+
+void CoinsImpl::setFrozen(std::string public_key)
+{
+ crypto::public_key pk;
+ if (!epee::string_tools::hex_to_pod(public_key, pk))
+ {
+ LOG_ERROR("Invalid public key: " << public_key);
+ return;
+ }
+
+ try
+ {
+ m_wallet->m_wallet->freeze(pk);
+ refresh();
+ }
+ catch (const std::exception& e)
+ {
+ LOG_ERROR("setFrozen: " << e.what());
+ }
+}
+
+void CoinsImpl::setFrozen(int index)
+{
+ try
+ {
+ m_wallet->m_wallet->freeze(index);
+ refresh();
+ }
+ catch (const std::exception& e)
+ {
+ LOG_ERROR("setLabel: " << e.what());
+ }
+}
+
+void CoinsImpl::thaw(std::string public_key)
+{
+ crypto::public_key pk;
+ if (!epee::string_tools::hex_to_pod(public_key, pk))
+ {
+ LOG_ERROR("Invalid public key: " << public_key);
+ return;
+ }
+
+ try
+ {
+ m_wallet->m_wallet->thaw(pk);
+ refresh();
+ }
+ catch (const std::exception& e)
+ {
+ LOG_ERROR("thaw: " << e.what());
+ }
+}
+
+void CoinsImpl::thaw(int index)
+{
+ try
+ {
+ m_wallet->m_wallet->thaw(index);
+ refresh();
+ }
+ catch (const std::exception& e)
+ {
+ LOG_ERROR("thaw: " << e.what());
+ }
+}
+
+bool CoinsImpl::isTransferUnlocked(uint64_t unlockTime, uint64_t blockHeight) {
+ return m_wallet->m_wallet->is_transfer_unlocked(unlockTime, blockHeight);
+}
+
+void CoinsImpl::setDescription(const std::string &public_key, const std::string &description)
+{
+ crypto::public_key pk;
+ if (!epee::string_tools::hex_to_pod(public_key, pk))
+ {
+ LOG_ERROR("Invalid public key: " << public_key);
+ return;
+ }
+
+ try
+ {
+ const size_t index = m_wallet->m_wallet->get_transfer_details(pk);
+ const tools::wallet2::transfer_details &td = m_wallet->m_wallet->get_transfer_details(index);
+ m_wallet->m_wallet->set_tx_note(td.m_txid, description);
+ refresh();
+ }
+ catch (const std::exception& e)
+ {
+ LOG_ERROR("setDescription: " << e.what());
+ }
+}
+
+} // namespace
diff --git a/src/wallet/api/coins.h b/src/wallet/api/coins.h
new file mode 100644
index 000000000..b7a0a8642
--- /dev/null
+++ b/src/wallet/api/coins.h
@@ -0,0 +1,40 @@
+#ifndef FEATHER_COINS_H
+#define FEATHER_COINS_H
+
+#include "wallet/api/wallet2_api.h"
+#include "wallet/wallet2.h"
+
+namespace Monero {
+
+class WalletImpl;
+
+class CoinsImpl : public Coins
+{
+public:
+ explicit CoinsImpl(WalletImpl * wallet);
+ ~CoinsImpl() override;
+ int count() const override;
+ CoinsInfo * coin(int index) const override;
+ std::vector<CoinsInfo*> getAll() const override;
+ void refresh() override;
+
+ void setFrozen(std::string public_key) override;
+ void setFrozen(int index) override;
+ void thaw(std::string public_key) override;
+ void thaw(int index) override;
+
+ bool isTransferUnlocked(uint64_t unlockTime, uint64_t blockHeight) override;
+
+ void setDescription(const std::string &public_key, const std::string &description) override;
+
+private:
+ WalletImpl *m_wallet;
+ std::vector<CoinsInfo*> m_rows;
+ mutable boost::shared_mutex m_rowsMutex;
+};
+
+}
+
+namespace Bitmonero = Monero;
+
+#endif //FEATHER_COINS_H
diff --git a/src/wallet/api/coins_info.cpp b/src/wallet/api/coins_info.cpp
new file mode 100644
index 000000000..5f2c4e1e4
--- /dev/null
+++ b/src/wallet/api/coins_info.cpp
@@ -0,0 +1,122 @@
+#include "coins_info.h"
+
+using namespace std;
+
+namespace Monero {
+
+CoinsInfo::~CoinsInfo() = default;
+
+CoinsInfoImpl::CoinsInfoImpl()
+ : m_blockHeight(0)
+ , m_internalOutputIndex(0)
+ , m_globalOutputIndex(0)
+ , m_spent(false)
+ , m_frozen(false)
+ , m_spentHeight(0)
+ , m_amount(0)
+ , m_rct(false)
+ , m_keyImageKnown(false)
+ , m_pkIndex(0)
+ , m_subaddrAccount(0)
+ , m_subaddrIndex(0)
+ , m_unlockTime(0)
+ , m_unlocked(false)
+{
+
+}
+
+CoinsInfoImpl::~CoinsInfoImpl() = default;
+
+uint64_t CoinsInfoImpl::blockHeight() const
+{
+ return m_blockHeight;
+}
+
+string CoinsInfoImpl::hash() const
+{
+ return m_hash;
+}
+
+size_t CoinsInfoImpl::internalOutputIndex() const {
+ return m_internalOutputIndex;
+}
+
+uint64_t CoinsInfoImpl::globalOutputIndex() const
+{
+ return m_globalOutputIndex;
+}
+
+bool CoinsInfoImpl::spent() const
+{
+ return m_spent;
+}
+
+bool CoinsInfoImpl::frozen() const
+{
+ return m_frozen;
+}
+
+uint64_t CoinsInfoImpl::spentHeight() const
+{
+ return m_spentHeight;
+}
+
+uint64_t CoinsInfoImpl::amount() const
+{
+ return m_amount;
+}
+
+bool CoinsInfoImpl::rct() const {
+ return m_rct;
+}
+
+bool CoinsInfoImpl::keyImageKnown() const {
+ return m_keyImageKnown;
+}
+
+size_t CoinsInfoImpl::pkIndex() const {
+ return m_pkIndex;
+}
+
+uint32_t CoinsInfoImpl::subaddrIndex() const {
+ return m_subaddrIndex;
+}
+
+uint32_t CoinsInfoImpl::subaddrAccount() const {
+ return m_subaddrAccount;
+}
+
+string CoinsInfoImpl::address() const {
+ return m_address;
+}
+
+string CoinsInfoImpl::addressLabel() const {
+ return m_addressLabel;
+}
+
+string CoinsInfoImpl::keyImage() const {
+ return m_keyImage;
+}
+
+uint64_t CoinsInfoImpl::unlockTime() const {
+ return m_unlockTime;
+}
+
+bool CoinsInfoImpl::unlocked() const {
+ return m_unlocked;
+}
+
+string CoinsInfoImpl::pubKey() const {
+ return m_pubKey;
+}
+
+bool CoinsInfoImpl::coinbase() const {
+ return m_coinbase;
+}
+
+string CoinsInfoImpl::description() const {
+ return m_description;
+}
+} // namespace
+
+namespace Bitmonero = Monero;
diff --git a/src/wallet/api/coins_info.h b/src/wallet/api/coins_info.h
new file mode 100644
index 000000000..c43e45abd
--- /dev/null
+++ b/src/wallet/api/coins_info.h
@@ -0,0 +1,71 @@
+#ifndef FEATHER_COINS_INFO_H
+#define FEATHER_COINS_INFO_H
+
+#include "wallet/api/wallet2_api.h"
+#include <string>
+#include <ctime>
+
+namespace Monero {
+
+class CoinsImpl;
+
+class CoinsInfoImpl : public CoinsInfo
+{
+public:
+ CoinsInfoImpl();
+ ~CoinsInfoImpl();
+
+ virtual uint64_t blockHeight() const override;
+ virtual std::string hash() const override;
+ virtual size_t internalOutputIndex() const override;
+ virtual uint64_t globalOutputIndex() const override;
+ virtual bool spent() const override;
+ virtual bool frozen() const override;
+ virtual uint64_t spentHeight() const override;
+ virtual uint64_t amount() const override;
+ virtual bool rct() const override;
+ virtual bool keyImageKnown() const override;
+ virtual size_t pkIndex() const override;
+ virtual uint32_t subaddrIndex() const override;
+ virtual uint32_t subaddrAccount() const override;
+ virtual std::string address() const override;
+ virtual std::string addressLabel() const override;
+ virtual std::string keyImage() const override;
+ virtual uint64_t unlockTime() const override;
+ virtual bool unlocked() const override;
+ virtual std::string pubKey() const override;
+ virtual bool coinbase() const override;
+ virtual std::string description() const override;
+
+private:
+ uint64_t m_blockHeight;
+ std::string m_hash;
+ size_t m_internalOutputIndex;
+ uint64_t m_globalOutputIndex;
+ bool m_spent;
+ bool m_frozen;
+ uint64_t m_spentHeight;
+ uint64_t m_amount;
+ bool m_rct;
+ bool m_keyImageKnown;
+ size_t m_pkIndex;
+ uint32_t m_subaddrIndex;
+ uint32_t m_subaddrAccount;
+ std::string m_address;
+ std::string m_addressLabel;
+ std::string m_keyImage;
+ uint64_t m_unlockTime;
+ bool m_unlocked;
+ std::string m_pubKey;
+ bool m_coinbase;
+ std::string m_description;
+
+ friend class CoinsImpl;
+
+};
+
+} // namespace
+
+namespace Bitmonero = Monero;
+
+#endif //FEATHER_COINS_INFO_H
diff --git a/src/wallet/api/wallet.cpp b/src/wallet/api/wallet.cpp
index 42887dced..2fe0d1d29 100644
--- a/src/wallet/api/wallet.cpp
+++ b/src/wallet/api/wallet.cpp
@@ -35,6 +35,7 @@
#include "transaction_history.h"
#include "address_book.h"
#include "subaddress.h"
+#include "coins.h"
#include "subaddress_account.h"
#include "common_defines.h"
#include "common/util.h"
@@ -469,6 +470,7 @@ WalletImpl::WalletImpl(NetworkType nettype, uint64_t kdf_rounds)
m_refreshEnabled = false;
m_addressBook.reset(new AddressBookImpl(this));
m_subaddress.reset(new SubaddressImpl(this));
+ m_coins.reset(new CoinsImpl(this));
m_subaddressAccount.reset(new SubaddressAccountImpl(this));
@@ -1752,7 +1754,7 @@ PendingTransaction* WalletImpl::restoreMultisigTransaction(const string& signDat
// - unconfirmed_transfer_details;
// - confirmed_transfer_details)
-PendingTransaction *WalletImpl::createTransactionMultDest(const std::vector<string> &dst_addr, const string &payment_id, optional<std::vector<uint64_t>> amount, uint32_t mixin_count, PendingTransaction::Priority priority, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices)
+PendingTransaction *WalletImpl::createTransactionMultDest(const std::vector<string> &dst_addr, const string &payment_id, optional<std::vector<uint64_t>> amount, uint32_t mixin_count, PendingTransaction::Priority priority, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::set<std::string> &preferred_inputs)
{
clearStatus();
@@ -1821,6 +1823,19 @@ PendingTransaction *WalletImpl::createTransactionMultDest(const std::vector<stri
}
}
}
+ std::vector<crypto::key_image> preferred_input_list;
+ if (!preferred_inputs.empty()) {
+ for (const auto &public_key : preferred_inputs) {
+ crypto::key_image keyImage;
+ bool r = epee::string_tools::hex_to_pod(public_key, keyImage);
+ if (!r) {
+ error = true;
+ setStatusError(tr("failed to parse key image"));
+ break;
+ }
+ preferred_input_list.push_back(keyImage);
+ }
+ }
if (error) {
break;
}
@@ -1833,13 +1848,14 @@ PendingTransaction *WalletImpl::createTransactionMultDest(const std::vector<stri
fake_outs_count = m_wallet->adjust_mixin(mixin_count);
if (amount) {
+ // (std::vector<cryptonote::tx_destination_entry> dsts, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const unique_index_container& subtract_fee_from_outputs, const std::vector<crypto::key_image>& preferred_input_list)
transaction->m_pending_tx = m_wallet->create_transactions_2(dsts, fake_outs_count, 0 /* unlock_time */,
adjusted_priority,
- extra, subaddr_account, subaddr_indices);
+ extra, subaddr_account, subaddr_indices, preferred_input_list);
} else {
transaction->m_pending_tx = m_wallet->create_transactions_all(0, info.address, info.is_subaddress, 1, fake_outs_count, 0 /* unlock_time */,
adjusted_priority,
- extra, subaddr_account, subaddr_indices);
+ extra, subaddr_account, subaddr_indices, preferred_input_list);
}
pendingTxPostProcess(transaction);
@@ -1920,10 +1936,10 @@ PendingTransaction *WalletImpl::createTransactionMultDest(const std::vector<stri
}
PendingTransaction *WalletImpl::createTransaction(const string &dst_addr, const string &payment_id, optional<uint64_t> amount, uint32_t mixin_count,
- PendingTransaction::Priority priority, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices)
+ PendingTransaction::Priority priority, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::set<std::string> &preferred_inputs)
{
- return createTransactionMultDest(std::vector<string> {dst_addr}, payment_id, amount ? (std::vector<uint64_t> {*amount}) : (optional<std::vector<uint64_t>>()), mixin_count, priority, subaddr_account, subaddr_indices);
+ return createTransactionMultDest(std::vector<string> {dst_addr}, payment_id, amount ? (std::vector<uint64_t> {*amount}) : (optional<std::vector<uint64_t>>()), mixin_count, priority, subaddr_account, subaddr_indices, preferred_inputs);
}
PendingTransaction *WalletImpl::createSweepUnmixableTransaction()
@@ -2048,6 +2064,11 @@ AddressBook *WalletImpl::addressBook()
return m_addressBook.get();
}
+Coins *WalletImpl::coins()
+{
+ return m_coins.get();
+}
+
Subaddress *WalletImpl::subaddress()
{
return m_subaddress.get();
diff --git a/src/wallet/api/wallet.h b/src/wallet/api/wallet.h
index 05d065c5c..4a16ca028 100644
--- a/src/wallet/api/wallet.h
+++ b/src/wallet/api/wallet.h
@@ -46,6 +46,7 @@ class PendingTransactionImpl;
class UnsignedTransactionImpl;
class AddressBookImpl;
class SubaddressImpl;
+class CoinsImpl;
class SubaddressAccountImpl;
struct Wallet2CallbackImpl;
@@ -167,12 +168,14 @@ public:
optional<std::vector<uint64_t>> amount, uint32_t mixin_count,
PendingTransaction::Priority priority = PendingTransaction::Priority_Low,
uint32_t subaddr_account = 0,
- std::set<uint32_t> subaddr_indices = {}) override;
+ std::set<uint32_t> subaddr_indices = {},
+ const std::set<std::string> &preferred_inputs = {}) override;
PendingTransaction * createTransaction(const std::string &dst_addr, const std::string &payment_id,
optional<uint64_t> amount, uint32_t mixin_count,
PendingTransaction::Priority priority = PendingTransaction::Priority_Low,
uint32_t subaddr_account = 0,
- std::set<uint32_t> subaddr_indices = {}) override;
+ std::set<uint32_t> subaddr_indices = {},
+ const std::set<std::string> &preferred_inputs = {}) override;
virtual PendingTransaction * createSweepUnmixableTransaction() override;
bool submitTransaction(const std::string &fileName) override;
virtual UnsignedTransaction * loadUnsignedTx(const std::string &unsigned_filename) override;
@@ -195,6 +198,7 @@ public:
PendingTransaction::Priority priority) const override;
virtual TransactionHistory * history() override;
virtual AddressBook * addressBook() override;
+ virtual Coins * coins() override;
virtual Subaddress * subaddress() override;
virtual SubaddressAccount * subaddressAccount() override;
virtual void setListener(WalletListener * l) override;
@@ -266,6 +270,7 @@ private:
friend class TransactionHistoryImpl;
friend struct Wallet2CallbackImpl;
friend class AddressBookImpl;
+ friend class CoinsImpl;
friend class SubaddressImpl;
friend class SubaddressAccountImpl;
@@ -282,6 +287,7 @@ private:
std::unique_ptr<Wallet2CallbackImpl> m_wallet2Callback;
std::unique_ptr<AddressBookImpl> m_addressBook;
std::unique_ptr<SubaddressImpl> m_subaddress;
+ std::unique_ptr<CoinsImpl> m_coins;
std::unique_ptr<SubaddressAccountImpl> m_subaddressAccount;
// multi-threaded refresh stuff
diff --git a/src/wallet/api/wallet2_api.h b/src/wallet/api/wallet2_api.h
index 4edaefefd..8a5c4135e 100644
--- a/src/wallet/api/wallet2_api.h
+++ b/src/wallet/api/wallet2_api.h
@@ -261,6 +261,51 @@ struct AddressBook
virtual int lookupPaymentID(const std::string &payment_id) const = 0;
};
+/**
+ * @brief The CoinsInfo - interface for displaying coins information
+ */
+struct CoinsInfo
+{
+ virtual ~CoinsInfo() = 0;
+
+ virtual uint64_t blockHeight() const = 0;
+ virtual std::string hash() const = 0;
+ virtual size_t internalOutputIndex() const = 0;
+ virtual uint64_t globalOutputIndex() const = 0;
+ virtual bool spent() const = 0;
+ virtual bool frozen() const = 0;
+ virtual uint64_t spentHeight() const = 0;
+ virtual uint64_t amount() const = 0;
+ virtual bool rct() const = 0;
+ virtual bool keyImageKnown() const = 0;
+ virtual size_t pkIndex() const = 0;
+ virtual uint32_t subaddrIndex() const = 0;
+ virtual uint32_t subaddrAccount() const = 0;
+ virtual std::string address() const = 0;
+ virtual std::string addressLabel() const = 0;
+ virtual std::string keyImage() const = 0;
+ virtual uint64_t unlockTime() const = 0;
+ virtual bool unlocked() const = 0;
+ virtual std::string pubKey() const = 0;
+ virtual bool coinbase() const = 0;
+ virtual std::string description() const = 0;
+};
+
+struct Coins
+{
+ virtual ~Coins() = 0;
+ virtual int count() const = 0;
+ virtual CoinsInfo * coin(int index) const = 0;
+ virtual std::vector<CoinsInfo*> getAll() const = 0;
+ virtual void refresh() = 0;
+ virtual void setFrozen(std::string public_key) = 0;
+ virtual void setFrozen(int index) = 0;
+ virtual void thaw(std::string public_key) = 0;
+ virtual void thaw(int index) = 0;
+ virtual bool isTransferUnlocked(uint64_t unlockTime, uint64_t blockHeight) = 0;
+ virtual void setDescription(const std::string &public_key, const std::string &description) = 0;
+};
+
struct SubaddressRow {
public:
SubaddressRow(std::size_t _rowId, const std::string &_address, const std::string &_label):
@@ -854,7 +899,8 @@ struct Wallet
optional<std::vector<uint64_t>> amount, uint32_t mixin_count,
PendingTransaction::Priority = PendingTransaction::Priority_Low,
uint32_t subaddr_account = 0,
- std::set<uint32_t> subaddr_indices = {}) = 0;
+ std::set<uint32_t> subaddr_indices = {},
+ const std::set<std::string> &preferred_inputs = {}) = 0;
/*!
* \brief createTransaction creates transaction. if dst_addr is an integrated address, payment_id is ignored
@@ -873,7 +919,8 @@ struct Wallet
optional<uint64_t> amount, uint32_t mixin_count,
PendingTransaction::Priority = PendingTransaction::Priority_Low,
uint32_t subaddr_account = 0,
- std::set<uint32_t> subaddr_indices = {}) = 0;
+ std::set<uint32_t> subaddr_indices = {},
+ const std::set<std::string> &preferred_inputs = {}) = 0;
/*!
* \brief createSweepUnmixableTransaction creates transaction with unmixable outputs.
@@ -987,6 +1034,7 @@ struct Wallet
virtual TransactionHistory * history() = 0;
virtual AddressBook * addressBook() = 0;
+ virtual Coins * coins() = 0;
virtual Subaddress * subaddress() = 0;
virtual SubaddressAccount * subaddressAccount() = 0;
virtual void setListener(WalletListener *) = 0;
diff --git a/src/wallet/wallet2.cpp b/src/wallet/wallet2.cpp
index 3477e084f..c3376f7e0 100644
--- a/src/wallet/wallet2.cpp
+++ b/src/wallet/wallet2.cpp
@@ -2081,12 +2081,21 @@ bool wallet2::frozen(const multisig_tx_set& txs) const
return false;
}
+void wallet2::freeze(const crypto::public_key &pk)
+{
+ freeze(get_transfer_details(pk));
+}
//----------------------------------------------------------------------------------------------------
void wallet2::freeze(const crypto::key_image &ki)
{
freeze(get_transfer_details(ki));
}
//----------------------------------------------------------------------------------------------------
+void wallet2::thaw(const crypto::public_key &pk)
+{
+ thaw(get_transfer_details(pk));
+}
+//----------------------------------------------------------------------------------------------------
void wallet2::thaw(const crypto::key_image &ki)
{
thaw(get_transfer_details(ki));
@@ -2097,6 +2106,18 @@ bool wallet2::frozen(const crypto::key_image &ki) const
return frozen(get_transfer_details(ki));
}
//----------------------------------------------------------------------------------------------------
+size_t wallet2::get_transfer_details(const crypto::public_key &pk) const
+{
+ for (size_t idx = 0; idx < m_transfers.size(); ++idx)
+ {
+ const transfer_details &td = m_transfers[idx];
+ if (td.get_public_key() == pk) {
+ return idx;
+ }
+ }
+ CHECK_AND_ASSERT_THROW_MES(false, "Public key not found");
+}
+//----------------------------------------------------------------------------------------------------
size_t wallet2::get_transfer_details(const crypto::key_image &ki) const
{
for (size_t idx = 0; idx < m_transfers.size(); ++idx)
@@ -2500,6 +2521,7 @@ void wallet2::process_new_transaction(const crypto::hash &txid, const cryptonote
uint64_t amount = tx.vout[o].amount ? tx.vout[o].amount : tx_scan_info[o].amount;
if (!pool)
{
+ boost::unique_lock<boost::shared_mutex> lock(m_transfers_mutex);
m_transfers.push_back(transfer_details{});
transfer_details& td = m_transfers.back();
td.m_block_height = height;
@@ -2603,6 +2625,7 @@ void wallet2::process_new_transaction(const crypto::hash &txid, const cryptonote
uint64_t extra_amount = amount - burnt;
if (!pool)
{
+ boost::unique_lock<boost::shared_mutex> lock(m_transfers_mutex);
transfer_details &td = m_transfers[kit->second];
td.m_block_height = height;
td.m_internal_output_index = o;
@@ -10495,7 +10518,7 @@ void wallet2::transfer_selected_rct(std::vector<cryptonote::tx_destination_entry
LOG_PRINT_L2("transfer_selected_rct done");
}
-std::vector<size_t> wallet2::pick_preferred_rct_inputs(uint64_t needed_money, uint32_t subaddr_account, const std::set<uint32_t> &subaddr_indices)
+std::vector<size_t> wallet2::pick_preferred_rct_inputs(uint64_t needed_money, uint32_t subaddr_account, const std::set<uint32_t> &subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list)
{
std::vector<size_t> picks;
float current_output_relatdness = 1.0f;
@@ -10506,6 +10529,9 @@ std::vector<size_t> wallet2::pick_preferred_rct_inputs(uint64_t needed_money, ui
for (size_t i = 0; i < m_transfers.size(); ++i)
{
const transfer_details& td = m_transfers[i];
+ if (!is_preferred_input(preferred_input_list, td.m_key_image)) {
+ continue;
+ }
if (!is_spent(td, false) && !td.m_frozen && td.is_rct() && td.amount() >= needed_money && is_transfer_unlocked(td) && td.m_subaddr_index.major == subaddr_account && subaddr_indices.count(td.m_subaddr_index.minor) == 1)
{
if (td.amount() > m_ignore_outputs_above || td.amount() < m_ignore_outputs_below)
@@ -10526,6 +10552,9 @@ std::vector<size_t> wallet2::pick_preferred_rct_inputs(uint64_t needed_money, ui
for (size_t i = 0; i < m_transfers.size(); ++i)
{
const transfer_details& td = m_transfers[i];
+ if (!is_preferred_input(preferred_input_list, td.m_key_image)) {
+ continue;
+ }
if (!is_spent(td, false) && !td.m_frozen && !td.m_key_image_partial && td.is_rct() && is_transfer_unlocked(td) && td.m_subaddr_index.major == subaddr_account && subaddr_indices.count(td.m_subaddr_index.minor) == 1)
{
if (td.amount() > m_ignore_outputs_above || td.amount() < m_ignore_outputs_below)
@@ -10537,6 +10566,9 @@ std::vector<size_t> wallet2::pick_preferred_rct_inputs(uint64_t needed_money, ui
for (size_t j = i + 1; j < m_transfers.size(); ++j)
{
const transfer_details& td2 = m_transfers[j];
+ if (!is_preferred_input(preferred_input_list, td2.m_key_image)) {
+ continue;
+ }
if (td2.amount() > m_ignore_outputs_above || td2.amount() < m_ignore_outputs_below)
{
MDEBUG("Ignoring output " << j << " of amount " << print_money(td2.amount()) << " which is outside prescribed range [" << print_money(m_ignore_outputs_below) << ", " << print_money(m_ignore_outputs_above) << "]");
@@ -11109,7 +11141,7 @@ bool wallet2::light_wallet_key_image_is_ours(const crypto::key_image& key_image,
// This system allows for sending (almost) the entire balance, since it does
// not generate spurious change in all txes, thus decreasing the instantaneous
// usable balance.
-std::vector<wallet2::pending_tx> wallet2::create_transactions_2(std::vector<cryptonote::tx_destination_entry> dsts, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const unique_index_container& subtract_fee_from_outputs)
+std::vector<wallet2::pending_tx> wallet2::create_transactions_2(std::vector<cryptonote::tx_destination_entry> dsts, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list, const unique_index_container& subtract_fee_from_outputs)
{
//ensure device is let in NONE mode in any case
hw::device &hwdev = m_account.get_device();
@@ -11317,6 +11349,9 @@ std::vector<wallet2::pending_tx> wallet2::create_transactions_2(std::vector<cryp
for (size_t i = 0; i < m_transfers.size(); ++i)
{
const transfer_details& td = m_transfers[i];
+ if (!is_preferred_input(preferred_input_list, td.m_key_image)) {
+ continue;
+ }
if (m_ignore_fractional_outputs && td.amount() < fractional_threshold)
{
MDEBUG("Ignoring output " << i << " of amount " << print_money(td.amount()) << " which is below fractional threshold " << print_money(fractional_threshold));
@@ -11401,7 +11436,7 @@ std::vector<wallet2::pending_tx> wallet2::create_transactions_2(std::vector<cryp
// will get us a known fee.
uint64_t estimated_fee = estimate_fee(use_per_byte_fee, use_rct, 2, fake_outs_count, 2, extra.size(), bulletproof, clsag, bulletproof_plus, use_view_tags, base_fee, fee_quantization_mask);
total_needed_money = needed_money + (subtract_fee_from_outputs.size() ? 0 : estimated_fee);
- preferred_inputs = pick_preferred_rct_inputs(total_needed_money, subaddr_account, subaddr_indices);
+ preferred_inputs = pick_preferred_rct_inputs(total_needed_money, subaddr_account, subaddr_indices, preferred_input_list);
if (!preferred_inputs.empty())
{
string s;
@@ -11882,7 +11917,7 @@ bool wallet2::sanity_check(const std::vector<wallet2::pending_tx> &ptx_vector, c
return true;
}
-std::vector<wallet2::pending_tx> wallet2::create_transactions_all(uint64_t below, const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices)
+std::vector<wallet2::pending_tx> wallet2::create_transactions_all(uint64_t below, const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list)
{
std::vector<size_t> unused_transfers_indices;
std::vector<size_t> unused_dust_indices;
@@ -11911,6 +11946,9 @@ std::vector<wallet2::pending_tx> wallet2::create_transactions_all(uint64_t below
for (size_t i = 0; i < m_transfers.size(); ++i)
{
const transfer_details& td = m_transfers[i];
+ if (!is_preferred_input(preferred_input_list, td.m_key_image)) {
+ continue;
+ }
if (m_ignore_fractional_outputs && td.amount() < fractional_threshold)
{
MDEBUG("Ignoring output " << i << " of amount " << print_money(td.amount()) << " which is below threshold " << print_money(fractional_threshold));
diff --git a/src/wallet/wallet2.h b/src/wallet/wallet2.h
index 406acac2b..5eae908ad 100644
--- a/src/wallet/wallet2.h
+++ b/src/wallet/wallet2.h
@@ -1207,8 +1207,8 @@ private:
bool parse_unsigned_tx_from_str(const std::string &unsigned_tx_st, unsigned_tx_set &exported_txs) const;
bool load_tx(const std::string &signed_filename, std::vector<tools::wallet2::pending_tx> &ptx, std::function<bool(const signed_tx_set&)> accept_func = NULL);
bool parse_tx_from_str(const std::string &signed_tx_st, std::vector<tools::wallet2::pending_tx> &ptx, std::function<bool(const signed_tx_set &)> accept_func);
- std::vector<wallet2::pending_tx> create_transactions_2(std::vector<cryptonote::tx_destination_entry> dsts, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const unique_index_container& subtract_fee_from_outputs = {}); // pass subaddr_indices by value on purpose
- std::vector<wallet2::pending_tx> create_transactions_all(uint64_t below, const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices);
+ std::vector<wallet2::pending_tx> create_transactions_2(std::vector<cryptonote::tx_destination_entry> dsts, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list = {}, const unique_index_container& subtract_fee_from_outputs = {}); // pass subaddr_indices by value on purpose
+ std::vector<wallet2::pending_tx> create_transactions_all(uint64_t below, const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra, uint32_t subaddr_account, std::set<uint32_t> subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list = {});
std::vector<wallet2::pending_tx> create_transactions_single(const crypto::key_image &ki, const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra);
std::vector<wallet2::pending_tx> create_transactions_from(const cryptonote::account_public_address &address, bool is_subaddress, const size_t outputs, std::vector<size_t> unused_transfers_indices, std::vector<size_t> unused_dust_indices, const size_t fake_outs_count, const uint64_t unlock_time, uint32_t priority, const std::vector<uint8_t>& extra);
bool sanity_check(const std::vector<wallet2::pending_tx> &ptx_vector, const std::vector<cryptonote::tx_destination_entry>& dsts, const unique_index_container& subtract_fee_from_outputs = {}) const;
@@ -1559,6 +1559,7 @@ private:
uint64_t get_num_rct_outputs();
size_t get_num_transfer_details() const { return m_transfers.size(); }
const transfer_details &get_transfer_details(size_t idx) const;
+ size_t get_transfer_details(const crypto::public_key &pk) const;
uint8_t get_current_hard_fork();
void get_hard_fork_info(uint8_t version, uint64_t &earliest_height);
@@ -1788,7 +1789,9 @@ private:
void freeze(size_t idx);
void thaw(size_t idx);
bool frozen(size_t idx) const;
+ void freeze(const crypto::public_key &pk);
void freeze(const crypto::key_image &ki);
+ void thaw(const crypto::public_key &pk);
void thaw(const crypto::key_image &ki);
bool frozen(const crypto::key_image &ki) const;
bool frozen(const transfer_details &td) const;
@@ -1829,6 +1832,8 @@ private:
static std::string get_default_daemon_address() { CRITICAL_REGION_LOCAL(default_daemon_address_lock); return default_daemon_address; }
+ boost::shared_mutex m_transfers_mutex;
+
private:
/*!
* \brief Stores wallet information to wallet file.
@@ -1892,7 +1897,7 @@ private:
std::vector<uint64_t> get_unspent_amounts_vector(bool strict);
uint64_t get_dynamic_base_fee_estimate();
float get_output_relatedness(const transfer_details &td0, const transfer_details &td1) const;
- std::vector<size_t> pick_preferred_rct_inputs(uint64_t needed_money, uint32_t subaddr_account, const std::set<uint32_t> &subaddr_indices);
+ std::vector<size_t> pick_preferred_rct_inputs(uint64_t needed_money, uint32_t subaddr_account, const std::set<uint32_t> &subaddr_indices, const std::vector<crypto::key_image>& preferred_input_list);
void set_spent(size_t idx, uint64_t height);
void set_unspent(size_t idx);
bool is_spent(const transfer_details &td, bool strict = true) const;